C34H48N2O5S — CID 20623323
2-[[4-[[2-(cyclohexylmethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 20623323) has the molecular formula C34H48N2O5S and a molecular weight of 596.83 g/mol. Its IUPAC name is 2-[[4-[[2-(cyclohexylmethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[4-[[2-(cyclohexylmethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 20623323 |
| Molecular Formula | C34H48N2O5S |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | 2-[[4-[[2-(cyclohexylmethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CCCC1CCC(CC2CCCCC2)N1Cc1ccc(C(=O)NC(CCS(C)(=O)=O)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C34H48N2O5S/c1-4-10-27-16-17-28(21-25-12-6-5-7-13-25)36(27)23-26-15-18-30(31(22-26)29-14-9-8-11-24(29)2)33(37)35-32(34(38)39)19-20-42(3,40)41/h8-9,11,14-15,18,22,25,27-28,32H,4-7,10,12-13,16-17,19-21,23H2,1-3H3,(H,35,37)(H,38,39) |
| InChIKey | HRDYNUMAPHYQQQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |