C35H50N2O4S — CID 70228571
(2S)-2-[[4-[[2-(cyclohexylmethoxymethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 70228571) has the molecular formula C35H50N2O4S and a molecular weight of 594.86 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-(cyclohexylmethoxymethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[2-(cyclohexylmethoxymethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 70228571 |
| Molecular Formula | C35H50N2O4S |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | (2S)-2-[[4-[[2-(cyclohexylmethoxymethyl)-5-propylpyrrolidin-1-yl]methyl]-2-(2-methylphenyl)benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCC1CCC(COCC2CCCCC2)N1Cc1ccc(C(=O)N[C@@H](CCSC)C(=O)O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C35H50N2O4S/c1-4-10-28-16-17-29(24-41-23-26-12-6-5-7-13-26)37(28)22-27-15-18-31(32(21-27)30-14-9-8-11-25(30)2)34(38)36-33(35(39)40)19-20-42-3/h8-9,11,14-15,18,21,26,28-29,33H,4-7,10,12-13,16-17,19-20,22-24H2,1-3H3,(H,36,38)(H,39,40)/t28?,29?,33-/m0/s1 |
| InChIKey | GZURRDZMKDZMEM-XRVMXHCPSA-N |
| XLogP | 7.33 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |