C8H12O4S — CID 20623991
2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 20623991) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | 2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 20623991 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)OC2C(=O)OC(CS)C2O1 |
| InChI | InChI=1S/C8H12O4S/c1-8(2)11-5-4(3-13)10-7(9)6(5)12-8/h4-6,13H,3H2,1-2H3 |
| InChIKey | NQEMUXDIEIBTEI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|