C8H13N3O2S2 — CID 20624483
tert-butyl N-methyl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamate (PubChem CID 20624483) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 20624483 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | tert-butyl N-methyl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C8H13N3O2S2/c1-8(2,3)13-7(12)11(4)5-9-10-6(14)15-5/h1-4H3,(H,10,14) |
| InChIKey | SBOFGAKQSVBEGU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|