C12H12F5NO2 — CID 172558948
tert-butyl N-methyl-N-(2,3,4,5,6-pentafluorophenyl)carbamate (PubChem CID 172558948) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(2,3,4,5,6-pentafluorophenyl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(2,3,4,5,6-pentafluorophenyl)carbamate |
|---|---|
| PubChem CID | 172558948 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | tert-butyl N-methyl-N-(2,3,4,5,6-pentafluorophenyl)carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO2/c1-12(2,3)20-11(19)18(4)10-8(16)6(14)5(13)7(15)9(10)17/h1-4H3 |
| InChIKey | PLHFCIOZRKOYBL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|