C17H30F3N3O6 — CID 57014425
tert-butyl N-[1,1-bis[fluoro-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N-fluorocarbamate (PubChem CID 57014425) has the molecular formula C17H30F3N3O6 and a molecular weight of 429.44 g/mol. Its IUPAC name is tert-butyl N-[1,1-bis[fluoro-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N-fluorocarbamate.
| Compound Name | tert-butyl N-[1,1-bis[fluoro-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N-fluorocarbamate |
|---|---|
| PubChem CID | 57014425 |
| Molecular Formula | C17H30F3N3O6 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | tert-butyl N-[1,1-bis[fluoro-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-N-fluorocarbamate |
| SMILES | CC(C)(C)OC(=O)N(F)C(C)(N(F)C(=O)OC(C)(C)C)N(F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30F3N3O6/c1-14(2,3)27-11(24)21(18)17(10,22(19)12(25)28-15(4,5)6)23(20)13(26)29-16(7,8)9/h1-10H3 |
| InChIKey | FHLXEFDKMVWDRX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|