C14H14F5NO4 — CID 151402954
(2R)-2-[2,3,4,5,6-pentafluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoic acid (PubChem CID 151402954) has the molecular formula C14H14F5NO4 and a molecular weight of 355.26 g/mol. Its IUPAC name is (2R)-2-[2,3,4,5,6-pentafluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoic acid.
| Compound Name | (2R)-2-[2,3,4,5,6-pentafluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 151402954 |
| Molecular Formula | C14H14F5NO4 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2R)-2-[2,3,4,5,6-pentafluoro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]propanoic acid |
| SMILES | C[C@H](C(=O)O)N(C(=O)OC(C)(C)C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H14F5NO4/c1-5(12(21)22)20(13(23)24-14(2,3)4)11-9(18)7(16)6(15)8(17)10(11)19/h5H,1-4H3,(H,21,22)/t5-/m1/s1 |
| InChIKey | OWWYPTVIHJNBPQ-RXMQYKEDSA-N |
| XLogP | 3.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|