C13H23NO5 — CID 22008880
2-[(2-methylpropan-2-yl)oxycarbonyl-(4-oxopentyl)amino]propanoic acid (PubChem CID 22008880) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonyl-(4-oxopentyl)amino]propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-(4-oxopentyl)amino]propanoic acid |
|---|---|
| PubChem CID | 22008880 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonyl-(4-oxopentyl)amino]propanoic acid |
| SMILES | CC(=O)CCCN(C(=O)OC(C)(C)C)C(C)C(=O)O |
| InChI | InChI=1S/C13H23NO5/c1-9(15)7-6-8-14(10(2)11(16)17)12(18)19-13(3,4)5/h10H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | WTDTWXSVOFMZNU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |