C13H25NO4 — CID 90464738
(2S)-2-[[(2S)-3-methylbutan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (PubChem CID 90464738) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-methylbutan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-methylbutan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90464738 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | (2S)-2-[[(2S)-3-methylbutan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| SMILES | CC(C)[C@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C13H25NO4/c1-8(2)9(3)14(10(4)11(15)16)12(17)18-13(5,6)7/h8-10H,1-7H3,(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | IAWJMGCXNRSONN-UWVGGRQHSA-N |
| XLogP | 2.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |