C24H27FN2O4 — CID 20626145
2-[3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 20626145) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-[3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 20626145 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-[3-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4-methoxyphenyl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | COc1ccc(C(=O)C(=O)N(C)C)cc1C(=O)N1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H27FN2O4/c1-26(2)24(30)22(28)18-6-9-21(31-3)20(15-18)23(29)27-12-10-17(11-13-27)14-16-4-7-19(25)8-5-16/h4-9,15,17H,10-14H2,1-3H3 |
| InChIKey | SHQCBIKUCPXMJJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|