C25H30N2O3S — CID 20629356
N-anthracen-1-yl-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 20629356) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-anthracen-1-yl-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-anthracen-1-yl-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20629356 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-anthracen-1-yl-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(C(=O)Nc2cccc3cc4ccccc4cc23)CC1 |
| InChI | InChI=1S/C25H30N2O3S/c1-25(2,3)31(29,30)27-21-13-11-17(12-14-21)24(28)26-23-10-6-9-20-15-18-7-4-5-8-19(18)16-22(20)23/h4-10,15-17,21,27H,11-14H2,1-3H3,(H,26,28) |
| InChIKey | JWMSEWWQPRDIRI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|