C21H34N2O5S — CID 20630419
N-(4-butoxy-2-hydroxyphenyl)-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 20630419) has the molecular formula C21H34N2O5S and a molecular weight of 426.58 g/mol. Its IUPAC name is N-(4-butoxy-2-hydroxyphenyl)-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-(4-butoxy-2-hydroxyphenyl)-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630419 |
| Molecular Formula | C21H34N2O5S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-(4-butoxy-2-hydroxyphenyl)-4-(tert-butylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2CCC(NS(=O)(=O)C(C)(C)C)CC2)c(O)c1 |
| InChI | InChI=1S/C21H34N2O5S/c1-5-6-13-28-17-11-12-18(19(24)14-17)22-20(25)15-7-9-16(10-8-15)23-29(26,27)21(2,3)4/h11-12,14-16,23-24H,5-10,13H2,1-4H3,(H,22,25) |
| InChIKey | NGRRAODVQZTPFX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|