C22H32F4N4O4S — CID 20630008
4-(tert-butylsulfonylamino)-N-[4-(2,6-dimethylmorpholin-4-yl)-2,3,5,6-tetrafluorophenyl]piperidine-1-carboxamide (PubChem CID 20630008) has the molecular formula C22H32F4N4O4S and a molecular weight of 524.58 g/mol. Its IUPAC name is 4-(tert-butylsulfonylamino)-N-[4-(2,6-dimethylmorpholin-4-yl)-2,3,5,6-tetrafluorophenyl]piperidine-1-carboxamide.
| Compound Name | 4-(tert-butylsulfonylamino)-N-[4-(2,6-dimethylmorpholin-4-yl)-2,3,5,6-tetrafluorophenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20630008 |
| Molecular Formula | C22H32F4N4O4S |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 4-(tert-butylsulfonylamino)-N-[4-(2,6-dimethylmorpholin-4-yl)-2,3,5,6-tetrafluorophenyl]piperidine-1-carboxamide |
| SMILES | CC1CN(c2c(F)c(F)c(NC(=O)N3CCC(NS(=O)(=O)C(C)(C)C)CC3)c(F)c2F)CC(C)O1 |
| InChI | InChI=1S/C22H32F4N4O4S/c1-12-10-30(11-13(2)34-12)20-17(25)15(23)19(16(24)18(20)26)27-21(31)29-8-6-14(7-9-29)28-35(32,33)22(3,4)5/h12-14,28H,6-11H2,1-5H3,(H,27,31) |
| InChIKey | DZOBBLPLLMEQBR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|