C28H29N5O4 — CID 20631651
methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate (PubChem CID 20631651) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 20631651 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)ccc2-c2ccc(C(=O)NCC(C)C)nc2C(=O)OC)cc1 |
| InChI | InChI=1S/C28H29N5O4/c1-5-17-6-11-20(22(14-17)26(34)32-19-9-7-18(8-10-19)25(29)30)21-12-13-23(27(35)31-15-16(2)3)33-24(21)28(36)37-4/h5-14,16H,1,15H2,2-4H3,(H3,29,30)(H,31,35)(H,32,34) |
| InChIKey | KIKKLEZXGRLVJK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|