C25H30N2O7 — CID 20631682
methyl 3-[4-ethenyl-2-(2-methoxyethoxymethoxycarbonyl)phenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate (PubChem CID 20631682) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is methyl 3-[4-ethenyl-2-(2-methoxyethoxymethoxycarbonyl)phenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-[4-ethenyl-2-(2-methoxyethoxymethoxycarbonyl)phenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 20631682 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | methyl 3-[4-ethenyl-2-(2-methoxyethoxymethoxycarbonyl)phenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate |
| SMILES | C=Cc1ccc(-c2ccc(C(=O)NCC(C)C)nc2C(=O)OC)c(C(=O)OCOCCOC)c1 |
| InChI | InChI=1S/C25H30N2O7/c1-6-17-7-8-18(20(13-17)24(29)34-15-33-12-11-31-4)19-9-10-21(23(28)26-14-16(2)3)27-22(19)25(30)32-5/h6-10,13,16H,1,11-12,14-15H2,2-5H3,(H,26,28) |
| InChIKey | IPLBKJSKVVXAQV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|