C10H16O2 — CID 20632849
1,5-dimethoxy-2,3-dimethylidenecyclohexane (PubChem CID 20632849) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,5-dimethoxy-2,3-dimethylidenecyclohexane.
| Compound Name | 1,5-dimethoxy-2,3-dimethylidenecyclohexane |
|---|---|
| PubChem CID | 20632849 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1,5-dimethoxy-2,3-dimethylidenecyclohexane |
| SMILES | C=C1CC(OC)CC(OC)C1=C |
| InChI | InChI=1S/C10H16O2/c1-7-5-9(11-3)6-10(12-4)8(7)2/h9-10H,1-2,5-6H2,3-4H3 |
| InChIKey | NODMFOWMSRRHIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |