C27H19N3 — CID 20634023
2-(1,2-diphenylindol-3-yl)-1H-benzimidazole (PubChem CID 20634023) has the molecular formula C27H19N3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-(1,2-diphenylindol-3-yl)-1H-benzimidazole.
| Compound Name | 2-(1,2-diphenylindol-3-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 20634023 |
| Molecular Formula | C27H19N3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-(1,2-diphenylindol-3-yl)-1H-benzimidazole |
| SMILES | c1ccc(-c2c(-c3nc4ccccc4[nH]3)c3ccccc3n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19N3/c1-3-11-19(12-4-1)26-25(27-28-22-16-8-9-17-23(22)29-27)21-15-7-10-18-24(21)30(26)20-13-5-2-6-14-20/h1-18H,(H,28,29) |
| InChIKey | MFWDXCOKTCNFPL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |