C11H8N4O2S — CID 20634278
3-(3-methylpyrazol-1-yl)-5-nitro-1,2-benzothiazole (PubChem CID 20634278) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 3-(3-methylpyrazol-1-yl)-5-nitro-1,2-benzothiazole.
| Compound Name | 3-(3-methylpyrazol-1-yl)-5-nitro-1,2-benzothiazole |
|---|---|
| PubChem CID | 20634278 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(3-methylpyrazol-1-yl)-5-nitro-1,2-benzothiazole |
| SMILES | Cc1ccn(-c2nsc3ccc([N+](=O)[O-])cc23)n1 |
| InChI | InChI=1S/C11H8N4O2S/c1-7-4-5-14(12-7)11-9-6-8(15(16)17)2-3-10(9)18-13-11/h2-6H,1H3 |
| InChIKey | YINNMOXVYKLICK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|