C10H8N2O3S — CID 119089312
5-nitro-3-prop-2-enoxy-1,2-benzothiazole (PubChem CID 119089312) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 5-nitro-3-prop-2-enoxy-1,2-benzothiazole.
| Compound Name | 5-nitro-3-prop-2-enoxy-1,2-benzothiazole |
|---|---|
| PubChem CID | 119089312 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 5-nitro-3-prop-2-enoxy-1,2-benzothiazole |
| SMILES | C=CCOc1nsc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C10H8N2O3S/c1-2-5-15-10-8-6-7(12(13)14)3-4-9(8)16-11-10/h2-4,6H,1,5H2 |
| InChIKey | XEQQOKPLYYXYDB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|