C28H24Cl2F7N5O2 — CID 20635748
7-(3,4-dichlorophenyl)-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-5-methyl-1,4-bis(2,2,2-trifluoroethyl)-7H-pyrazolo[1,5-a]pyrimidin-2-one (PubChem CID 20635748) has the molecular formula C28H24Cl2F7N5O2 and a molecular weight of 666.43 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-5-methyl-1,4-bis(2,2,2-trifluoroethyl)-7H-pyrazolo[1,5-a]pyrimidin-2-one.
| Compound Name | 7-(3,4-dichlorophenyl)-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-5-methyl-1,4-bis(2,2,2-trifluoroethyl)-7H-pyrazolo[1,5-a]pyrimidin-2-one |
|---|---|
| PubChem CID | 20635748 |
| Molecular Formula | C28H24Cl2F7N5O2 |
| Molecular Weight | 666.43 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-6-[4-(4-fluorophenyl)piperazine-1-carbonyl]-5-methyl-1,4-bis(2,2,2-trifluoroethyl)-7H-pyrazolo[1,5-a]pyrimidin-2-one |
| SMILES | CC1=C(C(=O)N2CCN(c3ccc(F)cc3)CC2)C(c2ccc(Cl)c(Cl)c2)n2c(cc(=O)n2CC(F)(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C28H24Cl2F7N5O2/c1-16-24(26(44)39-10-8-38(9-11-39)19-5-3-18(31)4-6-19)25(17-2-7-20(29)21(30)12-17)42-22(40(16)14-27(32,33)34)13-23(43)41(42)15-28(35,36)37/h2-7,12-13,25H,8-11,14-15H2,1H3 |
| InChIKey | VRTMGQGGSSESPU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |