About S-methyl 5-bromopentanethioate
S-methyl 5-bromopentanethioate (PubChem CID 20636388) has the molecular formula C6H11BrOS
and a molecular weight of 211.12 g/mol. Its IUPAC name is S-methyl 5-bromopentanethioate.
Molecular Properties
| Compound Name | S-methyl 5-bromopentanethioate |
| PubChem CID | 20636388 |
| Molecular Formula | C6H11BrOS |
| Molecular Weight | 211.12 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | S-methyl 5-bromopentanethioate |
| SMILES | CSC(=O)CCCCBr |
| InChI | InChI=1S/C6H11BrOS/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | BPSSFCQRWSLOKS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.12 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 5-bromopentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 5-bromopentanethioate?
The IUPAC name of S-methyl 5-bromopentanethioate (CID 20636388) is S-methyl 5-bromopentanethioate.
What is the SMILES notation for S-methyl 5-bromopentanethioate?
The canonical SMILES for S-methyl 5-bromopentanethioate is CSC(=O)CCCCBr.
What is the InChIKey of S-methyl 5-bromopentanethioate?
The InChIKey is BPSSFCQRWSLOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrOS/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3.
What are the key properties of S-methyl 5-bromopentanethioate?
S-methyl 5-bromopentanethioate has a molecular weight of 211.12 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 5-bromopentanethioate is sourced from PubChem (CID 20636388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).