C24H40O — CID 20638161
(E)-2-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]hex-5-en-3-yn-2-ol (PubChem CID 20638161) has the molecular formula C24H40O and a molecular weight of 344.58 g/mol. Its IUPAC name is (E)-2-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]hex-5-en-3-yn-2-ol.
| Compound Name | (E)-2-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]hex-5-en-3-yn-2-ol |
|---|---|
| PubChem CID | 20638161 |
| Molecular Formula | C24H40O |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | (E)-2-methyl-6-[4-(4-pentylcyclohexyl)cyclohexyl]hex-5-en-3-yn-2-ol |
| SMILES | CCCCCC1CCC(C2CCC(/C=C/C#CC(C)(C)O)CC2)CC1 |
| InChI | InChI=1S/C24H40O/c1-4-5-6-9-20-11-15-22(16-12-20)23-17-13-21(14-18-23)10-7-8-19-24(2,3)25/h7,10,20-23,25H,4-6,9,11-18H2,1-3H3/b10-7+ |
| InChIKey | SZZLANSORKRGBE-JXMROGBWSA-N |
| XLogP | 6.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|