C27H25F3N4O — CID 20641041
N-[(E)-[1-[5-[(E)-[ethyl(phenyl)hydrazinylidene]methyl]-1-benzofuran-2-yl]-3,3,3-trifluoropropylidene]amino]-N-methylaniline (PubChem CID 20641041) has the molecular formula C27H25F3N4O and a molecular weight of 478.52 g/mol. Its IUPAC name is N-[(E)-[1-[5-[(E)-[ethyl(phenyl)hydrazinylidene]methyl]-1-benzofuran-2-yl]-3,3,3-trifluoropropylidene]amino]-N-methylaniline.
| Compound Name | N-[(E)-[1-[5-[(E)-[ethyl(phenyl)hydrazinylidene]methyl]-1-benzofuran-2-yl]-3,3,3-trifluoropropylidene]amino]-N-methylaniline |
|---|---|
| PubChem CID | 20641041 |
| Molecular Formula | C27H25F3N4O |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[(E)-[1-[5-[(E)-[ethyl(phenyl)hydrazinylidene]methyl]-1-benzofuran-2-yl]-3,3,3-trifluoropropylidene]amino]-N-methylaniline |
| SMILES | CCN(/N=C/c1ccc2oc(/C(CC(F)(F)F)=N/N(C)c3ccccc3)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C27H25F3N4O/c1-3-34(23-12-8-5-9-13-23)31-19-20-14-15-25-21(16-20)17-26(35-25)24(18-27(28,29)30)32-33(2)22-10-6-4-7-11-22/h4-17,19H,3,18H2,1-2H3/b31-19+,32-24+ |
| InChIKey | NQWHJAGAYPARGD-SUCYDSBISA-N |
| XLogP | 7.09 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|