C25H21F3N4O — CID 20641048
N-methyl-N-[(E)-[2-[(Z)-N-(N-methylanilino)-C-(trifluoromethyl)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]aniline (PubChem CID 20641048) has the molecular formula C25H21F3N4O and a molecular weight of 450.46 g/mol. Its IUPAC name is N-methyl-N-[(E)-[2-[(Z)-N-(N-methylanilino)-C-(trifluoromethyl)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]aniline.
| Compound Name | N-methyl-N-[(E)-[2-[(Z)-N-(N-methylanilino)-C-(trifluoromethyl)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 20641048 |
| Molecular Formula | C25H21F3N4O |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-methyl-N-[(E)-[2-[(Z)-N-(N-methylanilino)-C-(trifluoromethyl)carbonimidoyl]-1-benzofuran-5-yl]methylideneamino]aniline |
| SMILES | CN(/N=C(/c1cc2cc(/C=N/N(C)c3ccccc3)ccc2o1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C25H21F3N4O/c1-31(20-9-5-3-6-10-20)29-17-18-13-14-22-19(15-18)16-23(33-22)24(25(26,27)28)30-32(2)21-11-7-4-8-12-21/h3-17H,1-2H3/b29-17+,30-24- |
| InChIKey | FWZZQTJYFOANHA-FWUBVTSKSA-N |
| XLogP | 6.31 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|