C15H19NO3S — CID 20642356
2-(N-[(1S,2R)-2-sulfanylcyclohexanecarbonyl]anilino)acetic acid (PubChem CID 20642356) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-(N-[(1S,2R)-2-sulfanylcyclohexanecarbonyl]anilino)acetic acid.
| Compound Name | 2-(N-[(1S,2R)-2-sulfanylcyclohexanecarbonyl]anilino)acetic acid |
|---|---|
| PubChem CID | 20642356 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-(N-[(1S,2R)-2-sulfanylcyclohexanecarbonyl]anilino)acetic acid |
| SMILES | O=C(O)CN(C(=O)[C@@H]1CCCC[C@H]1S)c1ccccc1 |
| InChI | InChI=1S/C15H19NO3S/c17-14(18)10-16(11-6-2-1-3-7-11)15(19)12-8-4-5-9-13(12)20/h1-3,6-7,12-13,20H,4-5,8-10H2,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | SMAAVMNTTZFUBD-CHWSQXEVSA-N |
| XLogP | 2.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|