C16H19NO4 — CID 60831127
2-[N-(bicyclo[2.2.1]heptane-2-carbonyl)-4-hydroxyanilino]acetic acid (PubChem CID 60831127) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[N-(bicyclo[2.2.1]heptane-2-carbonyl)-4-hydroxyanilino]acetic acid.
| Compound Name | 2-[N-(bicyclo[2.2.1]heptane-2-carbonyl)-4-hydroxyanilino]acetic acid |
|---|---|
| PubChem CID | 60831127 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[N-(bicyclo[2.2.1]heptane-2-carbonyl)-4-hydroxyanilino]acetic acid |
| SMILES | O=C(O)CN(C(=O)C1CC2CCC1C2)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H19NO4/c18-13-5-3-12(4-6-13)17(9-15(19)20)16(21)14-8-10-1-2-11(14)7-10/h3-6,10-11,14,18H,1-2,7-9H2,(H,19,20) |
| InChIKey | DSXBYJGSGKILEI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |