C31H39N5O4 — CID 20642431
N-methyl-N-(2-phenylpropyl)-4-[3-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]propyl]cyclohexan-1-amine;oxalic acid (PubChem CID 20642431) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-methyl-N-(2-phenylpropyl)-4-[3-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]propyl]cyclohexan-1-amine;oxalic acid.
| Compound Name | N-methyl-N-(2-phenylpropyl)-4-[3-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]propyl]cyclohexan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 20642431 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | N-methyl-N-(2-phenylpropyl)-4-[3-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]propyl]cyclohexan-1-amine;oxalic acid |
| SMILES | CC(CN(C)C1CCC(CCCc2c[nH]c3ccc(-n4cnnc4)cc23)CC1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H37N5.C2H2O4/c1-22(24-8-4-3-5-9-24)19-33(2)26-13-11-23(12-14-26)7-6-10-25-18-30-29-16-15-27(17-28(25)29)34-20-31-32-21-34;3-1(4)2(5)6/h3-5,8-9,15-18,20-23,26,30H,6-7,10-14,19H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | PEJIUVAXYHTEOO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|