C12H12N4 — CID 57263001
3-ethyl-5-(1,2,4-triazol-4-yl)-1H-indole (PubChem CID 57263001) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 3-ethyl-5-(1,2,4-triazol-4-yl)-1H-indole.
| Compound Name | 3-ethyl-5-(1,2,4-triazol-4-yl)-1H-indole |
|---|---|
| PubChem CID | 57263001 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-ethyl-5-(1,2,4-triazol-4-yl)-1H-indole |
| SMILES | CCc1c[nH]c2ccc(-n3cnnc3)cc12 |
| InChI | InChI=1S/C12H12N4/c1-2-9-6-13-12-4-3-10(5-11(9)12)16-7-14-15-8-16/h3-8,13H,2H2,1H3 |
| InChIKey | FEWIKIVVAIGDNS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |