C20H24N6O2 — CID 57301007
methyl 1-[2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]ethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 57301007) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is methyl 1-[2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]ethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | methyl 1-[2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]ethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 57301007 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | methyl 1-[2-[5-(1,2,4-triazol-4-yl)-1H-indol-3-yl]ethyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | COC(=O)N1CC2CCN(CCc3c[nH]c4ccc(-n5cnnc5)cc34)C2C1 |
| InChI | InChI=1S/C20H24N6O2/c1-28-20(27)25-10-15-5-7-24(19(15)11-25)6-4-14-9-21-18-3-2-16(8-17(14)18)26-12-22-23-13-26/h2-3,8-9,12-13,15,19,21H,4-7,10-11H2,1H3 |
| InChIKey | RVDYSQICBVYGOZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |