C14H21Y+2 — CID 20642617
3,3,4-trimethylpentan-2-ylbenzene;yttrium(3+) (PubChem CID 20642617) has the molecular formula C14H21Y+2 and a molecular weight of 278.23 g/mol. Its IUPAC name is 3,3,4-trimethylpentan-2-ylbenzene;yttrium(3+).
| Compound Name | 3,3,4-trimethylpentan-2-ylbenzene;yttrium(3+) |
|---|---|
| PubChem CID | 20642617 |
| Molecular Formula | C14H21Y+2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3,3,4-trimethylpentan-2-ylbenzene;yttrium(3+) |
| SMILES | C[C-](C)C(C)(C)C(C)c1ccccc1.[Y+3] |
| InChI | InChI=1S/C14H21.Y/c1-11(2)14(4,5)12(3)13-9-7-6-8-10-13;/h6-10,12H,1-5H3;/q-1;+3 |
| InChIKey | YMPWRSIPAHGUCT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|