C26H16O5S2 — CID 20643597
(2Z)-2-[(3-methyl-1,1-dioxobenzo[f][1]benzothiol-2-yl)methylidene]-1,1-dioxobenzo[f][1]benzothiol-3-one (PubChem CID 20643597) has the molecular formula C26H16O5S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is (2Z)-2-[(3-methyl-1,1-dioxobenzo[f][1]benzothiol-2-yl)methylidene]-1,1-dioxobenzo[f][1]benzothiol-3-one.
| Compound Name | (2Z)-2-[(3-methyl-1,1-dioxobenzo[f][1]benzothiol-2-yl)methylidene]-1,1-dioxobenzo[f][1]benzothiol-3-one |
|---|---|
| PubChem CID | 20643597 |
| Molecular Formula | C26H16O5S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | (2Z)-2-[(3-methyl-1,1-dioxobenzo[f][1]benzothiol-2-yl)methylidene]-1,1-dioxobenzo[f][1]benzothiol-3-one |
| SMILES | CC1=C(/C=C2/C(=O)c3cc4ccccc4cc3S2(=O)=O)S(=O)(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C26H16O5S2/c1-15-20-10-16-6-2-4-8-18(16)12-23(20)32(28,29)22(15)14-25-26(27)21-11-17-7-3-5-9-19(17)13-24(21)33(25,30)31/h2-14H,1H3/b25-14- |
| InChIKey | CLZKZROJKKFRAT-QFEZKATASA-N |
| XLogP | 5.07 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|