C13H28N+ — CID 20644247
1,1,2,2,3,3,4,4-octamethylpiperidin-1-ium (PubChem CID 20644247) has the molecular formula C13H28N+ and a molecular weight of 198.37 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octamethylpiperidin-1-ium.
| Compound Name | 1,1,2,2,3,3,4,4-octamethylpiperidin-1-ium |
|---|---|
| PubChem CID | 20644247 |
| Molecular Formula | C13H28N+ |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.22 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octamethylpiperidin-1-ium |
| SMILES | CC1(C)CC[N+](C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H28N/c1-11(2)9-10-14(7,8)13(5,6)12(11,3)4/h9-10H2,1-8H3/q+1 |
| InChIKey | PTWHKOWCXZZEDQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|