C25H32BrClN4OS — CID 20644553
3-amino-1-[4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-butylpiperazin-1-yl]-2-sulfanylpropan-1-one (PubChem CID 20644553) has the molecular formula C25H32BrClN4OS and a molecular weight of 551.98 g/mol. Its IUPAC name is 3-amino-1-[4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-butylpiperazin-1-yl]-2-sulfanylpropan-1-one.
| Compound Name | 3-amino-1-[4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-butylpiperazin-1-yl]-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 20644553 |
| Molecular Formula | C25H32BrClN4OS |
| Molecular Weight | 551.98 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 3-amino-1-[4-(6-bromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-2-butylpiperazin-1-yl]-2-sulfanylpropan-1-one |
| SMILES | CCCCC1CN(C2c3ccc(Cl)cc3CCc3cc(Br)cnc32)CCN1C(=O)C(S)CN |
| InChI | InChI=1S/C25H32BrClN4OS/c1-2-3-4-20-15-30(9-10-31(20)25(32)22(33)13-28)24-21-8-7-19(27)12-16(21)5-6-17-11-18(26)14-29-23(17)24/h7-8,11-12,14,20,22,24,33H,2-6,9-10,13,15,28H2,1H3 |
| InChIKey | DNMWPFGCQYNGET-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|