About 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one
6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one (PubChem CID 20644798) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one.
Molecular Properties
| Compound Name | 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one |
| PubChem CID | 20644798 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one |
| SMILES | [H]/N=C/C1=NCCC(=O)C1 |
| InChI | InChI=1S/C6H8N2O/c7-4-5-3-6(9)1-2-8-5/h4,7H,1-3H2/b7-4+ |
| InChIKey | WKNZIXBDDKRSSQ-QPJJXVBHSA-N |
| XLogP | 0.44 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one?
The IUPAC name of 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one (CID 20644798) is 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one.
What is the SMILES notation for 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one?
The canonical SMILES for 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one is [H]/N=C/C1=NCCC(=O)C1.
What is the InChIKey of 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one?
The InChIKey is WKNZIXBDDKRSSQ-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H8N2O/c7-4-5-3-6(9)1-2-8-5/h4,7H,1-3H2/b7-4+.
What are the key properties of 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one?
6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one has a molecular weight of 124.14 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methanimidoyl-3,5-dihydro-2H-pyridin-4-one is sourced from PubChem (CID 20644798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).