About 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one
5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one (PubChem CID 91136729) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one.
Molecular Properties
| Compound Name | 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one |
| PubChem CID | 91136729 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one |
| SMILES | CC1N=CC(N)CC1=O |
| InChI | InChI=1S/C6H10N2O/c1-4-6(9)2-5(7)3-8-4/h3-5H,2,7H2,1H3 |
| InChIKey | SMFZFNSYYBBSBL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one?
The IUPAC name of 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one (CID 91136729) is 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one.
What is the SMILES notation for 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one?
The canonical SMILES for 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one is CC1N=CC(N)CC1=O.
What is the InChIKey of 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one?
The InChIKey is SMFZFNSYYBBSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-4-6(9)2-5(7)3-8-4/h3-5H,2,7H2,1H3.
What are the key properties of 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one?
5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one has a molecular weight of 126.16 g/mol, XLogP of -0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-methyl-4,5-dihydro-2H-pyridin-3-one is sourced from PubChem (CID 91136729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).