C8H15N3O — CID 123186515
3-amino-5,6-bis(methylimino)hexan-2-one (PubChem CID 123186515) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-amino-5,6-bis(methylimino)hexan-2-one.
| Compound Name | 3-amino-5,6-bis(methylimino)hexan-2-one |
|---|---|
| PubChem CID | 123186515 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-amino-5,6-bis(methylimino)hexan-2-one |
| SMILES | C/N=C(\C=N\C)CC(N)C(C)=O |
| InChI | InChI=1S/C8H15N3O/c1-6(12)8(9)4-7(11-3)5-10-2/h5,8H,4,9H2,1-3H3/b10-5+,11-7- |
| InChIKey | GJEGCOMQRJKFMM-OGDGOULISA-N |
| XLogP | 0.06 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|