About 2-aminopentan-3-one;N-methylpentan-3-imine
2-aminopentan-3-one;N-methylpentan-3-imine (PubChem CID 159010839) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-aminopentan-3-one;N-methylpentan-3-imine.
Molecular Properties
| Compound Name | 2-aminopentan-3-one;N-methylpentan-3-imine |
| PubChem CID | 159010839 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-aminopentan-3-one;N-methylpentan-3-imine |
| SMILES | CCC(=O)C(C)N.CCC(CC)=NC |
| InChI | InChI=1S/C6H13N.C5H11NO/c1-4-6(5-2)7-3;1-3-5(7)4(2)6/h4-5H2,1-3H3;4H,3,6H2,1-2H3 |
| InChIKey | JSLURYXHGRBUJQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopentan-3-one;N-methylpentan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentan-3-one;N-methylpentan-3-imine?
The IUPAC name of 2-aminopentan-3-one;N-methylpentan-3-imine (CID 159010839) is 2-aminopentan-3-one;N-methylpentan-3-imine.
What is the SMILES notation for 2-aminopentan-3-one;N-methylpentan-3-imine?
The canonical SMILES for 2-aminopentan-3-one;N-methylpentan-3-imine is CCC(=O)C(C)N.CCC(CC)=NC.
What is the InChIKey of 2-aminopentan-3-one;N-methylpentan-3-imine?
The InChIKey is JSLURYXHGRBUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H11NO/c1-4-6(5-2)7-3;1-3-5(7)4(2)6/h4-5H2,1-3H3;4H,3,6H2,1-2H3.
What are the key properties of 2-aminopentan-3-one;N-methylpentan-3-imine?
2-aminopentan-3-one;N-methylpentan-3-imine has a molecular weight of 200.33 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentan-3-one;N-methylpentan-3-imine is sourced from PubChem (CID 159010839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).