About ethanamine;N-ethylpentan-2-imine;pentan-2-one
ethanamine;N-ethylpentan-2-imine;pentan-2-one (PubChem CID 159085250) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is ethanamine;N-ethylpentan-2-imine;pentan-2-one.
Molecular Properties
| Compound Name | ethanamine;N-ethylpentan-2-imine;pentan-2-one |
| PubChem CID | 159085250 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | ethanamine;N-ethylpentan-2-imine;pentan-2-one |
| SMILES | CCC/C(C)=N/CC.CCCC(C)=O.CCN |
| InChI | InChI=1S/C7H15N.C5H10O.C2H7N/c1-4-6-7(3)8-5-2;1-3-4-5(2)6;1-2-3/h4-6H2,1-3H3;3-4H2,1-2H3;2-3H2,1H3/b8-7+;; |
| InChIKey | KBJFVNAONGVRCC-MIIBGCIDSA-N |
| XLogP | 3.61 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;N-ethylpentan-2-imine;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;N-ethylpentan-2-imine;pentan-2-one?
The IUPAC name of ethanamine;N-ethylpentan-2-imine;pentan-2-one (CID 159085250) is ethanamine;N-ethylpentan-2-imine;pentan-2-one.
What is the SMILES notation for ethanamine;N-ethylpentan-2-imine;pentan-2-one?
The canonical SMILES for ethanamine;N-ethylpentan-2-imine;pentan-2-one is CCC/C(C)=N/CC.CCCC(C)=O.CCN.
What is the InChIKey of ethanamine;N-ethylpentan-2-imine;pentan-2-one?
The InChIKey is KBJFVNAONGVRCC-MIIBGCIDSA-N. The full InChI is InChI=1S/C7H15N.C5H10O.C2H7N/c1-4-6-7(3)8-5-2;1-3-4-5(2)6;1-2-3/h4-6H2,1-3H3;3-4H2,1-2H3;2-3H2,1H3/b8-7+;;.
What are the key properties of ethanamine;N-ethylpentan-2-imine;pentan-2-one?
ethanamine;N-ethylpentan-2-imine;pentan-2-one has a molecular weight of 244.42 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;N-ethylpentan-2-imine;pentan-2-one is sourced from PubChem (CID 159085250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).