About 3-amino-4-iminopentan-2-one;ethane;methanamine
3-amino-4-iminopentan-2-one;ethane;methanamine (PubChem CID 143689652) has the molecular formula C8H21N3O
and a molecular weight of 175.28 g/mol. Its IUPAC name is 3-amino-4-iminopentan-2-one;ethane;methanamine.
Molecular Properties
| Compound Name | 3-amino-4-iminopentan-2-one;ethane;methanamine |
| PubChem CID | 143689652 |
| Molecular Formula | C8H21N3O |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.17 |
| IUPAC Name | 3-amino-4-iminopentan-2-one;ethane;methanamine |
| SMILES | CC.CN.[H]/N=C(\C)C(N)C(C)=O |
| InChI | InChI=1S/C5H10N2O.C2H6.CH5N/c1-3(6)5(7)4(2)8;2*1-2/h5-6H,7H2,1-2H3;1-2H3;2H2,1H3/b6-3+;; |
| InChIKey | BGWBMJVEXLRYMU-RRHCXGJISA-N |
| XLogP | 0.54 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-iminopentan-2-one;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-iminopentan-2-one;ethane;methanamine?
The IUPAC name of 3-amino-4-iminopentan-2-one;ethane;methanamine (CID 143689652) is 3-amino-4-iminopentan-2-one;ethane;methanamine.
What is the SMILES notation for 3-amino-4-iminopentan-2-one;ethane;methanamine?
The canonical SMILES for 3-amino-4-iminopentan-2-one;ethane;methanamine is CC.CN.[H]/N=C(\C)C(N)C(C)=O.
What is the InChIKey of 3-amino-4-iminopentan-2-one;ethane;methanamine?
The InChIKey is BGWBMJVEXLRYMU-RRHCXGJISA-N. The full InChI is InChI=1S/C5H10N2O.C2H6.CH5N/c1-3(6)5(7)4(2)8;2*1-2/h5-6H,7H2,1-2H3;1-2H3;2H2,1H3/b6-3+;;.
What are the key properties of 3-amino-4-iminopentan-2-one;ethane;methanamine?
3-amino-4-iminopentan-2-one;ethane;methanamine has a molecular weight of 175.28 g/mol, XLogP of 0.54, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-iminopentan-2-one;ethane;methanamine is sourced from PubChem (CID 143689652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).