C8H9NaO4 — CID 20645592
sodium 4-acetyl-2,2-dimethyl-5-oxofuran-3-olate (PubChem CID 20645592) has the molecular formula C8H9NaO4 and a molecular weight of 192.15 g/mol. Its IUPAC name is sodium 4-acetyl-2,2-dimethyl-5-oxofuran-3-olate.
| Compound Name | sodium 4-acetyl-2,2-dimethyl-5-oxofuran-3-olate |
|---|---|
| PubChem CID | 20645592 |
| Molecular Formula | C8H9NaO4 |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | sodium 4-acetyl-2,2-dimethyl-5-oxofuran-3-olate |
| SMILES | CC(=O)C1=C([O-])C(C)(C)OC1=O.[Na+] |
| InChI | InChI=1S/C8H10O4.Na/c1-4(9)5-6(10)8(2,3)12-7(5)11;/h10H,1-3H3;/q;+1/p-1 |
| InChIKey | CGRVYBFDGQZPHR-UHFFFAOYSA-M |
| XLogP | -3.47 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|