C19H24N4O3S2 — CID 20647092
2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]furan-3-sulfonamide (PubChem CID 20647092) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]furan-3-sulfonamide.
| Compound Name | 2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 20647092 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2,4-dimethyl-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]furan-3-sulfonamide |
| SMILES | Cc1coc(C)c1S(=O)(=O)NCCCCCNc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C19H24N4O3S2/c1-14-12-26-15(2)18(14)28(24,25)22-11-6-3-5-10-21-19-23-17(13-27-19)16-8-4-7-9-20-16/h4,7-9,12-13,22H,3,5-6,10-11H2,1-2H3,(H,21,23) |
| InChIKey | GJBXWSWJIYHQIZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|