C22H25N3O4S2 — CID 70697358
ethyl (E)-2-[4-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]butoxy]phenyl]ethenesulfonate (PubChem CID 70697358) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is ethyl (E)-2-[4-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]butoxy]phenyl]ethenesulfonate.
| Compound Name | ethyl (E)-2-[4-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]butoxy]phenyl]ethenesulfonate |
|---|---|
| PubChem CID | 70697358 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | ethyl (E)-2-[4-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]butoxy]phenyl]ethenesulfonate |
| SMILES | CCOS(=O)(=O)/C=C/c1ccc(OCCCCNc2nc(-c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-2-29-31(26,27)16-12-18-8-10-19(11-9-18)28-15-6-5-14-24-22-25-21(17-30-22)20-7-3-4-13-23-20/h3-4,7-13,16-17H,2,5-6,14-15H2,1H3,(H,24,25)/b16-12+ |
| InChIKey | LMEDYMTXRWZJBL-FOWTUZBSSA-N |
| XLogP | 4.81 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|