C40H49N5O7 — CID 20648090
(2,6-dimethylcyclohexyl) 2-[5-[2-(2,4-dimethylphenoxy)hexanoylamino]-2-methoxyphenyl]-6-isocyano-5-(2-methylpropanoyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20648090) has the molecular formula C40H49N5O7 and a molecular weight of 711.86 g/mol. Its IUPAC name is (2,6-dimethylcyclohexyl) 2-[5-[2-(2,4-dimethylphenoxy)hexanoylamino]-2-methoxyphenyl]-6-isocyano-5-(2-methylpropanoyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-dimethylcyclohexyl) 2-[5-[2-(2,4-dimethylphenoxy)hexanoylamino]-2-methoxyphenyl]-6-isocyano-5-(2-methylpropanoyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20648090 |
| Molecular Formula | C40H49N5O7 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.36 |
| IUPAC Name | (2,6-dimethylcyclohexyl) 2-[5-[2-(2,4-dimethylphenoxy)hexanoylamino]-2-methoxyphenyl]-6-isocyano-5-(2-methylpropanoyloxy)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CCCC2C)c2nc(-c3cc(NC(=O)C(CCCC)Oc4ccc(C)cc4C)ccc3OC)[nH]n2c1OC(=O)C(C)C |
| InChI | InChI=1S/C40H49N5O7/c1-10-11-15-31(50-29-18-16-23(4)20-26(29)7)37(46)42-27-17-19-30(49-9)28(21-27)35-43-36-32(40(48)51-34-24(5)13-12-14-25(34)6)33(41-8)38(45(36)44-35)52-39(47)22(2)3/h16-22,24-25,31,34H,10-15H2,1-7,9H3,(H,42,46)(H,43,44) |
| InChIKey | AFHGMVZGJKRRPS-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|