C12H18O5 — CID 20648279
methyl 2,4,6-trimethyl-5-(methylperoxymethyl)-4H-pyran-3-carboxylate (PubChem CID 20648279) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 2,4,6-trimethyl-5-(methylperoxymethyl)-4H-pyran-3-carboxylate.
| Compound Name | methyl 2,4,6-trimethyl-5-(methylperoxymethyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 20648279 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl 2,4,6-trimethyl-5-(methylperoxymethyl)-4H-pyran-3-carboxylate |
| SMILES | COOCC1=C(C)OC(C)=C(C(=O)OC)C1C |
| InChI | InChI=1S/C12H18O5/c1-7-10(6-16-15-5)8(2)17-9(3)11(7)12(13)14-4/h7H,6H2,1-5H3 |
| InChIKey | ZCPKKYSHUBHKFH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|