C20H22F6O8 — CID 139146516
ethyl (4R)-6-methyl-2-oxo-4-(trifluoromethyl)-3,4-dihydropyran-5-carboxylate (PubChem CID 139146516) has the molecular formula C20H22F6O8 and a molecular weight of 504.38 g/mol. Its IUPAC name is ethyl (4R)-6-methyl-2-oxo-4-(trifluoromethyl)-3,4-dihydropyran-5-carboxylate.
| Compound Name | ethyl (4R)-6-methyl-2-oxo-4-(trifluoromethyl)-3,4-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 139146516 |
| Molecular Formula | C20H22F6O8 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | ethyl (4R)-6-methyl-2-oxo-4-(trifluoromethyl)-3,4-dihydropyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(=O)C[C@H]1C(F)(F)F.CCOC(=O)C1=C(C)OC(=O)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/2C10H11F3O4/c2*1-3-16-9(15)8-5(2)17-7(14)4-6(8)10(11,12)13/h2*6H,3-4H2,1-2H3/t2*6-/m11/s1 |
| InChIKey | HBBLRSISXWSANI-BYZBDTJCSA-N |
| XLogP | 3.90 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|