C20H20O8 — CID 85242641
7,17-di(ethylidene)-3,9,13,19-tetraoxatricyclo[14.4.0.06,11]icosa-1(20),10-diene-2,8,12,18-tetrone (PubChem CID 85242641) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is 7,17-di(ethylidene)-3,9,13,19-tetraoxatricyclo[14.4.0.06,11]icosa-1(20),10-diene-2,8,12,18-tetrone.
| Compound Name | 7,17-di(ethylidene)-3,9,13,19-tetraoxatricyclo[14.4.0.06,11]icosa-1(20),10-diene-2,8,12,18-tetrone |
|---|---|
| PubChem CID | 85242641 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 7,17-di(ethylidene)-3,9,13,19-tetraoxatricyclo[14.4.0.06,11]icosa-1(20),10-diene-2,8,12,18-tetrone |
| SMILES | CC=C1C(=O)OC=C2C(=O)OCCC3C(=CC)C(=O)OC=C3C(=O)OCCC12 |
| InChI | InChI=1S/C20H20O8/c1-3-11-13-5-7-25-20(24)16-10-28-18(22)12(4-2)14(16)6-8-26-19(23)15(13)9-27-17(11)21/h3-4,9-10,13-14H,5-8H2,1-2H3 |
| InChIKey | XSMCGBMHWHHXCY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|