C8H12N2O2 — CID 20648600
1-[2-(methylamino)acetyl]-2,5-dihydropyrrole-2-carbaldehyde (PubChem CID 20648600) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-[2-(methylamino)acetyl]-2,5-dihydropyrrole-2-carbaldehyde.
| Compound Name | 1-[2-(methylamino)acetyl]-2,5-dihydropyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 20648600 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-[2-(methylamino)acetyl]-2,5-dihydropyrrole-2-carbaldehyde |
| SMILES | CNCC(=O)N1CC=CC1C=O |
| InChI | InChI=1S/C8H12N2O2/c1-9-5-8(12)10-4-2-3-7(10)6-11/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | AHSMNSFQCRDQDE-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|