C9H13N3O2 — CID 167446415
4-formyl-1-[2-(methylamino)acetyl]pyrrolidine-2-carbonitrile (PubChem CID 167446415) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-formyl-1-[2-(methylamino)acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | 4-formyl-1-[2-(methylamino)acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 167446415 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4-formyl-1-[2-(methylamino)acetyl]pyrrolidine-2-carbonitrile |
| SMILES | CNCC(=O)N1CC(C=O)CC1C#N |
| InChI | InChI=1S/C9H13N3O2/c1-11-4-9(14)12-5-7(6-13)2-8(12)3-10/h6-8,11H,2,4-5H2,1H3 |
| InChIKey | BUAWJJLJOAJLOP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|