About 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one
1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one (PubChem CID 20648622) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one.
Analyze 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one?
The IUPAC name of 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one (CID 20648622) is 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one.
What is the SMILES notation for 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one?
The canonical SMILES for 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one is CCC(=O)N1CSCC1CO.
What is the InChIKey of 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one?
The InChIKey is GZHKJJWPANTCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-2-7(10)8-5-11-4-6(8)3-9/h6,9H,2-5H2,1H3.
What are the key properties of 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one?
1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one has a molecular weight of 175.25 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propan-1-one is sourced from PubChem (CID 20648622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).