C7H13NO2S — CID 141150519
3-(1-hydroxyethyl)-4,5-dimethyl-1,3-thiazolidin-2-one (PubChem CID 141150519) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-4,5-dimethyl-1,3-thiazolidin-2-one.
| Compound Name | 3-(1-hydroxyethyl)-4,5-dimethyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 141150519 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-(1-hydroxyethyl)-4,5-dimethyl-1,3-thiazolidin-2-one |
| SMILES | CC1SC(=O)N(C(C)O)C1C |
| InChI | InChI=1S/C7H13NO2S/c1-4-5(2)11-7(10)8(4)6(3)9/h4-6,9H,1-3H3 |
| InChIKey | NUUWHBMJPBLYLW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|